C45H60N8O4Si2 — CID 66583597
ethyl 4-[6-(benzotriazol-1-yl)-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate (PubChem CID 66583597) has the molecular formula C45H60N8O4Si2 and a molecular weight of 833.20 g/mol. Its IUPAC name is ethyl 4-[6-(benzotriazol-1-yl)-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[6-(benzotriazol-1-yl)-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583597 |
| Molecular Formula | C45H60N8O4Si2 |
| Molecular Weight | 833.20 g/mol |
| Exact Mass | 832.43 |
| IUPAC Name | ethyl 4-[6-(benzotriazol-1-yl)-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2-n2nnc3ccccc32)CC1 |
| InChI | InChI=1S/C45H60N8O4Si2/c1-9-57-44(54)45(2)23-21-34(22-24-45)40-41(52-39-18-14-13-17-38(39)49-50-52)43(51(31-55-25-27-58(3,4)5)32-56-26-28-59(6,7)8)53-42(48-40)36(30-47-53)35-19-20-37(46-29-35)33-15-11-10-12-16-33/h10-20,29-30,34H,9,21-28,31-32H2,1-8H3 |
| InChIKey | LMWVNDKEOFAZKD-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 121.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.20 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|