C40H56N6O4Si2 — CID 66583613
ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate (PubChem CID 66583613) has the molecular formula C40H56N6O4Si2 and a molecular weight of 741.10 g/mol. Its IUPAC name is ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583613 |
| Molecular Formula | C40H56N6O4Si2 |
| Molecular Weight | 741.10 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2C#N)CC1 |
| InChI | InChI=1S/C40H56N6O4Si2/c1-9-50-39(47)40(2)19-17-31(18-20-40)36-33(25-41)38(45(28-48-21-23-51(3,4)5)29-49-22-24-52(6,7)8)46-37(44-36)34(27-43-46)32-15-16-35(42-26-32)30-13-11-10-12-14-30/h10-16,26-27,31H,9,17-24,28-29H2,1-8H3 |
| InChIKey | DZIFUBYKGZWIFN-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 114.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.10 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|