C40H63N7O7Si2 — CID 66583625
2-methoxyethyl 4-[6-amino-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate (PubChem CID 66583625) has the molecular formula C40H63N7O7Si2 and a molecular weight of 810.16 g/mol. Its IUPAC name is 2-methoxyethyl 4-[6-amino-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate.
| Compound Name | 2-methoxyethyl 4-[6-amino-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583625 |
| Molecular Formula | C40H63N7O7Si2 |
| Molecular Weight | 810.16 g/mol |
| Exact Mass | 809.43 |
| IUPAC Name | 2-methoxyethyl 4-[6-amino-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
| SMILES | COCCOC(=O)C1(OCCOC)CCC(c2nc3c(-c4cnn(-c5ccccc5)c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2N)CC1 |
| InChI | InChI=1S/C40H63N7O7Si2/c1-49-18-20-53-39(48)40(54-21-19-50-2)16-14-31(15-17-40)36-35(41)38(45(29-51-22-24-55(3,4)5)30-52-23-25-56(6,7)8)47-37(44-36)34(27-43-47)32-26-42-46(28-32)33-12-10-9-11-13-33/h9-13,26-28,31H,14-25,29-30,41H2,1-8H3 |
| InChIKey | BRKMFBMCQMTDBO-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.16 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|