C36H59N5O8Si2 — CID 66583727
2-hydroxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(hydroxymethyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate (PubChem CID 66583727) has the molecular formula C36H59N5O8Si2 and a molecular weight of 746.07 g/mol. Its IUPAC name is 2-hydroxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(hydroxymethyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate.
| Compound Name | 2-hydroxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(hydroxymethyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583727 |
| Molecular Formula | C36H59N5O8Si2 |
| Molecular Weight | 746.07 g/mol |
| Exact Mass | 745.39 |
| IUPAC Name | 2-hydroxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(hydroxymethyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
| SMILES | COCCOC1(C(=O)OCCO)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(CO)nc4)c3n2)CC1 |
| InChI | InChI=1S/C36H59N5O8Si2/c1-45-16-17-49-36(35(44)48-15-14-42)12-10-28(11-13-36)32-22-33(40(26-46-18-20-50(2,3)4)27-47-19-21-51(5,6)7)41-34(39-32)31(24-38-41)29-8-9-30(25-43)37-23-29/h8-9,22-24,28,42-43H,10-21,25-27H2,1-7H3 |
| InChIKey | CYMHQYNFBODUHT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.07 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|