C40H62N6O7Si2 — CID 66583728
2-methoxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate (PubChem CID 66583728) has the molecular formula C40H62N6O7Si2 and a molecular weight of 795.14 g/mol. Its IUPAC name is 2-methoxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate.
| Compound Name | 2-methoxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583728 |
| Molecular Formula | C40H62N6O7Si2 |
| Molecular Weight | 795.14 g/mol |
| Exact Mass | 794.42 |
| IUPAC Name | 2-methoxyethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
| SMILES | COCCOC(=O)C1(OCCOC)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnn(-c5ccccc5)c4)c3n2)CC1 |
| InChI | InChI=1S/C40H62N6O7Si2/c1-48-18-20-52-39(47)40(53-21-19-49-2)16-14-32(15-17-40)36-26-37(44(30-50-22-24-54(3,4)5)31-51-23-25-55(6,7)8)46-38(43-36)35(28-42-46)33-27-41-45(29-33)34-12-10-9-11-13-34/h9-13,26-29,32H,14-25,30-31H2,1-8H3 |
| InChIKey | VGKZWDZWWBRSCR-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.14 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|