C36H53BrN6O4SSi2 — CID 66583840
methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylsulfanylcyclohexane-1-carboxylate (PubChem CID 66583840) has the molecular formula C36H53BrN6O4SSi2 and a molecular weight of 802.00 g/mol. Its IUPAC name is methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylsulfanylcyclohexane-1-carboxylate.
| Compound Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylsulfanylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583840 |
| Molecular Formula | C36H53BrN6O4SSi2 |
| Molecular Weight | 802.00 g/mol |
| Exact Mass | 800.26 |
| IUPAC Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylsulfanylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(SC)CCC(c2nc3c(-c4cnn(-c5ccccc5)c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C36H53BrN6O4SSi2/c1-45-35(44)36(48-2)16-14-27(15-17-36)32-31(37)34(41(25-46-18-20-49(3,4)5)26-47-19-21-50(6,7)8)43-33(40-32)30(23-39-43)28-22-38-42(24-28)29-12-10-9-11-13-29/h9-13,22-24,27H,14-21,25-26H2,1-8H3 |
| InChIKey | ZEWUFTTZBYDPOV-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 96.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.00 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|