C33H46IN7O6Si — CID 66583889
2-methoxyethyl 4-[3-[6-(1H-imidazol-2-yl)-3-pyridinyl]-6-iodo-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate (PubChem CID 66583889) has the molecular formula C33H46IN7O6Si and a molecular weight of 791.76 g/mol. Its IUPAC name is 2-methoxyethyl 4-[3-[6-(1H-imidazol-2-yl)-3-pyridinyl]-6-iodo-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate.
| Compound Name | 2-methoxyethyl 4-[3-[6-(1H-imidazol-2-yl)-3-pyridinyl]-6-iodo-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583889 |
| Molecular Formula | C33H46IN7O6Si |
| Molecular Weight | 791.76 g/mol |
| Exact Mass | 791.23 |
| IUPAC Name | 2-methoxyethyl 4-[3-[6-(1H-imidazol-2-yl)-3-pyridinyl]-6-iodo-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylate |
| SMILES | COCCOC(=O)C1(OCCOC)CCC(c2nc3c(-c4ccc(-c5ncc[nH]5)nc4)cnn3c(NCOCC[Si](C)(C)C)c2I)CC1 |
| InChI | InChI=1S/C33H46IN7O6Si/c1-43-14-16-46-32(42)33(47-17-15-44-2)10-8-23(9-11-33)28-27(34)31(38-22-45-18-19-48(3,4)5)41-30(40-28)25(21-39-41)24-6-7-26(37-20-24)29-35-12-13-36-29/h6-7,12-13,20-21,23,38H,8-11,14-19,22H2,1-5H3,(H,35,36) |
| InChIKey | VYRMXCZGBRUSMX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.76 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|