C25H46IN5O3Si2 — CID 66583898
5-(4-amino-4-methoxycyclohexyl)-3-iodo-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66583898) has the molecular formula C25H46IN5O3Si2 and a molecular weight of 647.75 g/mol. Its IUPAC name is 5-(4-amino-4-methoxycyclohexyl)-3-iodo-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(4-amino-4-methoxycyclohexyl)-3-iodo-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66583898 |
| Molecular Formula | C25H46IN5O3Si2 |
| Molecular Weight | 647.75 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | 5-(4-amino-4-methoxycyclohexyl)-3-iodo-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COC1(N)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(I)c3n2)CC1 |
| InChI | InChI=1S/C25H46IN5O3Si2/c1-32-25(27)10-8-20(9-11-25)22-16-23(31-24(29-22)21(26)17-28-31)30(18-33-12-14-35(2,3)4)19-34-13-15-36(5,6)7/h16-17,20H,8-15,18-19,27H2,1-7H3 |
| InChIKey | PVOCIPVMMKQHHF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.75 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|