C37H55N5O4Si2 — CID 66583946
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-hydroxyethyl)cyclohexan-1-ol (PubChem CID 66583946) has the molecular formula C37H55N5O4Si2 and a molecular weight of 690.05 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-hydroxyethyl)cyclohexan-1-ol.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-hydroxyethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 66583946 |
| Molecular Formula | C37H55N5O4Si2 |
| Molecular Weight | 690.05 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-hydroxyethyl)cyclohexan-1-ol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC(O)(CCO)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C37H55N5O4Si2/c1-47(2,3)22-20-45-27-41(28-46-21-23-48(4,5)6)35-24-34(30-14-16-37(44,17-15-30)18-19-43)40-36-32(26-39-42(35)36)31-12-13-33(38-25-31)29-10-8-7-9-11-29/h7-13,24-26,30,43-44H,14-23,27-28H2,1-6H3 |
| InChIKey | WKCJMISXQBXNFH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.05 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|