C41H62N6O6Si2 — CID 66583983
ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexane-1-carboxylate (PubChem CID 66583983) has the molecular formula C41H62N6O6Si2 and a molecular weight of 791.15 g/mol. Its IUPAC name is ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583983 |
| Molecular Formula | C41H62N6O6Si2 |
| Molecular Weight | 791.15 g/mol |
| Exact Mass | 790.43 |
| IUPAC Name | ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexane-1-carboxylate |
| SMILES | C=C(OCC)c1c(C2CCC(CO)(C(=O)OCC)CC2)nc2c(-c3cnn(-c4ccccc4)c3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C41H62N6O6Si2/c1-10-52-31(3)36-37(32-17-19-41(28-48,20-18-32)40(49)53-11-2)44-38-35(33-25-42-46(27-33)34-15-13-12-14-16-34)26-43-47(38)39(36)45(29-50-21-23-54(4,5)6)30-51-22-24-55(7,8)9/h12-16,25-27,32,48H,3,10-11,17-24,28-30H2,1-2,4-9H3 |
| InChIKey | GQBBUKHBTVQMRX-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.15 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|