C36H53N5O4Si2 — CID 66583993
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexan-1-ol (PubChem CID 66583993) has the molecular formula C36H53N5O4Si2 and a molecular weight of 676.02 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexan-1-ol.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 66583993 |
| Molecular Formula | C36H53N5O4Si2 |
| Molecular Weight | 676.02 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(hydroxymethyl)cyclohexan-1-ol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC(O)(CO)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C36H53N5O4Si2/c1-46(2,3)20-18-44-26-40(27-45-19-21-47(4,5)6)34-22-33(29-14-16-36(43,25-42)17-15-29)39-35-31(24-38-41(34)35)30-12-13-32(37-23-30)28-10-8-7-9-11-28/h7-13,22-24,29,42-43H,14-21,25-27H2,1-6H3 |
| InChIKey | DRMQWGKJMLKMPQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.02 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|