About 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one
4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one (PubChem CID 66584096) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one |
| PubChem CID | 66584096 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one |
| SMILES | C1=NCCN1.C=CN1CCCC1=O |
| InChI | InChI=1S/C6H9NO.C3H6N2/c1-2-7-5-3-4-6(7)8;1-2-5-3-4-1/h2H,1,3-5H2;3H,1-2H2,(H,4,5) |
| InChIKey | FGUYVKJJEQNPMA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
The IUPAC name of 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one (CID 66584096) is 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
The canonical SMILES for 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one is C1=NCCN1.C=CN1CCCC1=O.
What is the InChIKey of 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
The InChIKey is FGUYVKJJEQNPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C3H6N2/c1-2-7-5-3-4-6(7)8;1-2-5-3-4-1/h2H,1,3-5H2;3H,1-2H2,(H,4,5).
What are the key properties of 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one has a molecular weight of 181.24 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 66584096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).