C8H11NO2 — CID 66584263
2,3,7,7a-tetrahydro-1H-indole-2,5-diol (PubChem CID 66584263) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 2,3,7,7a-tetrahydro-1H-indole-2,5-diol.
| Compound Name | 2,3,7,7a-tetrahydro-1H-indole-2,5-diol |
|---|---|
| PubChem CID | 66584263 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2,3,7,7a-tetrahydro-1H-indole-2,5-diol |
| SMILES | OC1=CCC2NC(O)CC2=C1 |
| InChI | InChI=1S/C8H11NO2/c10-6-1-2-7-5(3-6)4-8(11)9-7/h1,3,7-11H,2,4H2 |
| InChIKey | WVWYEZIVIMJRGV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |