C24H22ClF4N5O2 — CID 66584282
N-[4-(3-chloro-4-fluoroanilino)-7-(trifluoromethoxy)quinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide (PubChem CID 66584282) has the molecular formula C24H22ClF4N5O2 and a molecular weight of 523.92 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(trifluoromethoxy)quinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(trifluoromethoxy)quinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 66584282 |
| Molecular Formula | C24H22ClF4N5O2 |
| Molecular Weight | 523.92 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(trifluoromethoxy)quinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide |
| SMILES | O=C(C=CCN1CCCCC1)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC(F)(F)F |
| InChI | InChI=1S/C24H22ClF4N5O2/c25-17-11-15(6-7-18(17)26)32-23-16-12-20(21(36-24(27,28)29)13-19(16)30-14-31-23)33-22(35)5-4-10-34-8-2-1-3-9-34/h4-7,11-14H,1-3,8-10H2,(H,33,35)(H,30,31,32) |
| InChIKey | CRKXEIAEAGVNNS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.92 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|