C34H51FN6O3Si2 — CID 66584551
3-(6-fluoroquinolin-3-yl)-5-[1-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66584551) has the molecular formula C34H51FN6O3Si2 and a molecular weight of 666.99 g/mol. Its IUPAC name is 3-(6-fluoroquinolin-3-yl)-5-[1-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-(6-fluoroquinolin-3-yl)-5-[1-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66584551 |
| Molecular Formula | C34H51FN6O3Si2 |
| Molecular Weight | 666.99 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | 3-(6-fluoroquinolin-3-yl)-5-[1-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(NC1CCOCC1)c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n2ncc(-c3cnc4ccc(F)cc4c3)c2n1 |
| InChI | InChI=1S/C34H51FN6O3Si2/c1-25(38-29-10-12-42-13-11-29)32-20-33(40(23-43-14-16-45(2,3)4)24-44-15-17-46(5,6)7)41-34(39-32)30(22-37-41)27-18-26-19-28(35)8-9-31(26)36-21-27/h8-9,18-22,25,29,38H,10-17,23-24H2,1-7H3 |
| InChIKey | FLYNPJKVNHGRHL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.99 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|