C34H51FN6O3Si2 — CID 66584552
3-(6-fluoroquinolin-3-yl)-5-[2-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66584552) has the molecular formula C34H51FN6O3Si2 and a molecular weight of 666.99 g/mol. Its IUPAC name is 3-(6-fluoroquinolin-3-yl)-5-[2-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-(6-fluoroquinolin-3-yl)-5-[2-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66584552 |
| Molecular Formula | C34H51FN6O3Si2 |
| Molecular Weight | 666.99 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | 3-(6-fluoroquinolin-3-yl)-5-[2-(oxan-4-ylamino)ethyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(CCNC2CCOCC2)nc2c(-c3cnc4ccc(F)cc4c3)cnn12 |
| InChI | InChI=1S/C34H51FN6O3Si2/c1-45(2,3)17-15-43-24-40(25-44-16-18-46(4,5)6)33-21-30(9-12-36-29-10-13-42-14-11-29)39-34-31(23-38-41(33)34)27-19-26-20-28(35)7-8-32(26)37-22-27/h7-8,19-23,29,36H,9-18,24-25H2,1-6H3 |
| InChIKey | PLJZNFZKUHNZRM-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.99 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|