C29H43FN6O2Si2 — CID 66584565
5-(2-aminoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66584565) has the molecular formula C29H43FN6O2Si2 and a molecular weight of 582.87 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(2-aminoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66584565 |
| Molecular Formula | C29H43FN6O2Si2 |
| Molecular Weight | 582.87 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 5-(2-aminoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(CCN)nc2c(-c3cnc4ccc(F)cc4c3)cnn12 |
| InChI | InChI=1S/C29H43FN6O2Si2/c1-39(2,3)13-11-37-20-35(21-38-12-14-40(4,5)6)28-17-25(9-10-31)34-29-26(19-33-36(28)29)23-15-22-16-24(30)7-8-27(22)32-18-23/h7-8,15-19H,9-14,20-21,31H2,1-6H3 |
| InChIKey | CHTIKQLLZLAFHG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|