About (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate
(2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate (PubChem CID 66584671) has the molecular formula C26H44N2O2
and a molecular weight of 416.65 g/mol. Its IUPAC name is (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate |
| PubChem CID | 66584671 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCc1ncc(OC(=O)C2CCC(CCCCCCC)CC2)cn1 |
| InChI | InChI=1S/C26H44N2O2/c1-3-5-7-9-11-13-15-25-27-20-24(21-28-25)30-26(29)23-18-16-22(17-19-23)14-12-10-8-6-4-2/h20-23H,3-19H2,1-2H3 |
| InChIKey | MCJLESQYNVIUHB-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate?
The IUPAC name of (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate (CID 66584671) is (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate.
What is the SMILES notation for (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate?
The canonical SMILES for (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate is CCCCCCCCc1ncc(OC(=O)C2CCC(CCCCCCC)CC2)cn1.
What is the InChIKey of (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate?
The InChIKey is MCJLESQYNVIUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H44N2O2/c1-3-5-7-9-11-13-15-25-27-20-24(21-28-25)30-26(29)23-18-16-22(17-19-23)14-12-10-8-6-4-2/h20-23H,3-19H2,1-2H3.
What are the key properties of (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate?
(2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate has a molecular weight of 416.65 g/mol, XLogP of 7.45, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-octylpyrimidin-5-yl) 4-heptylcyclohexane-1-carboxylate is sourced from PubChem (CID 66584671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).