C44H28N4 — CID 66584706
2,3,5,7-tetraphenylporphyrin (PubChem CID 66584706) has the molecular formula C44H28N4 and a molecular weight of 612.74 g/mol. Its IUPAC name is 2,3,5,7-tetraphenylporphyrin.
| Compound Name | 2,3,5,7-tetraphenylporphyrin |
|---|---|
| PubChem CID | 66584706 |
| Molecular Formula | C44H28N4 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 2,3,5,7-tetraphenylporphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C1=N2)C=C5c1ccccc1)C(c1ccccc1)=C4c1ccccc1)C=C3 |
| InChI | InChI=1S/C44H28N4/c1-5-13-29(14-6-1)38-27-37-26-35-22-21-33(45-35)25-34-23-24-36(46-34)28-39-40(30-15-7-2-8-16-30)41(31-17-9-3-10-18-31)44(48-39)42(43(38)47-37)32-19-11-4-12-20-32/h1-28H/b33-25-,34-25-,35-26-,36-28-,37-26-,39-28-,43-42-,44-42- |
| InChIKey | AVGAZDDBFCNKGQ-CIMVNTPJSA-N |
| XLogP | 9.69 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|