C39H60N8O4Si2 — CID 66584758
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 66584758) has the molecular formula C39H60N8O4Si2 and a molecular weight of 761.13 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 66584758 |
| Molecular Formula | C39H60N8O4Si2 |
| Molecular Weight | 761.13 g/mol |
| Exact Mass | 760.43 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cn1ccc(-c2ccc(-c3cnn4c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C5CC6CCC(C5)N6C(=O)OC(C)(C)C)nc34)cn2)n1 |
| InChI | InChI=1S/C39H60N8O4Si2/c1-39(2,3)51-38(48)46-30-12-13-31(46)22-29(21-30)35-23-36(45(26-49-17-19-52(5,6)7)27-50-18-20-53(8,9)10)47-37(42-35)32(25-41-47)28-11-14-33(40-24-28)34-15-16-44(4)43-34/h11,14-16,23-25,29-31H,12-13,17-22,26-27H2,1-10H3 |
| InChIKey | DEIHPMMCRUTBNT-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.13 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|