C43H64N6O5Si2 — CID 66584806
tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 66584806) has the molecular formula C43H64N6O5Si2 and a molecular weight of 801.19 g/mol. Its IUPAC name is tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66584806 |
| Molecular Formula | C43H64N6O5Si2 |
| Molecular Weight | 801.19 g/mol |
| Exact Mass | 800.45 |
| IUPAC Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | C=C(OCC)c1c(C2CCN(C(=O)OC(C)(C)C)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C43H64N6O5Si2/c1-12-53-32(2)38-39(34-20-22-47(23-21-34)42(50)54-43(3,4)5)46-40-36(35-18-19-37(44-28-35)33-16-14-13-15-17-33)29-45-49(40)41(38)48(30-51-24-26-55(6,7)8)31-52-25-27-56(9,10)11/h13-19,28-29,34H,2,12,20-27,30-31H2,1,3-11H3 |
| InChIKey | NDGQBGVHOADBAC-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 103.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.19 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|