About 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine
5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66584856) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 66584856 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1cc(C2CCSCC2)nc2ccnn12 |
| InChI | InChI=1S/C11H14N4S/c12-10-7-9(8-2-5-16-6-3-8)14-11-1-4-13-15(10)11/h1,4,7-8H,2-3,5-6,12H2 |
| InChIKey | OSFDBIJOJILXGU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 66584856) is 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine is Nc1cc(C2CCSCC2)nc2ccnn12.
What is the InChIKey of 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is OSFDBIJOJILXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c12-10-7-9(8-2-5-16-6-3-8)14-11-1-4-13-15(10)11/h1,4,7-8H,2-3,5-6,12H2.
What are the key properties of 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 234.33 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thian-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 66584856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).