C19H19BrO — CID 66584883
6'-bromospiro[1,2,5,6,8,9-hexahydrobenzo[7]annulene-7,2'-3H-indene]-1'-one (PubChem CID 66584883) has the molecular formula C19H19BrO and a molecular weight of 343.26 g/mol. Its IUPAC name is 6'-bromospiro[1,2,5,6,8,9-hexahydrobenzo[7]annulene-7,2'-3H-indene]-1'-one.
| Compound Name | 6'-bromospiro[1,2,5,6,8,9-hexahydrobenzo[7]annulene-7,2'-3H-indene]-1'-one |
|---|---|
| PubChem CID | 66584883 |
| Molecular Formula | C19H19BrO |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 6'-bromospiro[1,2,5,6,8,9-hexahydrobenzo[7]annulene-7,2'-3H-indene]-1'-one |
| SMILES | O=C1c2cc(Br)ccc2CC12CCC1=C(CCC=C1)CC2 |
| InChI | InChI=1S/C19H19BrO/c20-16-6-5-15-12-19(18(21)17(15)11-16)9-7-13-3-1-2-4-14(13)8-10-19/h1,3,5-6,11H,2,4,7-10,12H2 |
| InChIKey | KRVHWDVGHMKNBR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |