About 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol
4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol (PubChem CID 66586145) has the molecular formula C14H17N3O3S2
and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol.
Molecular Properties
| Compound Name | 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol |
| PubChem CID | 66586145 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2nccs2)CCN1c1ccc(O)cc1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-11-10-16(22(19,20)14-15-6-9-21-14)7-8-17(11)12-2-4-13(18)5-3-12/h2-6,9,11,18H,7-8,10H2,1H3/t11-/m0/s1 |
| InChIKey | VNJAJMZKIQXUCY-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol?
The IUPAC name of 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol (CID 66586145) is 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol.
What is the SMILES notation for 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol?
The canonical SMILES for 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol is C[C@H]1CN(S(=O)(=O)c2nccs2)CCN1c1ccc(O)cc1.
What is the InChIKey of 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol?
The InChIKey is VNJAJMZKIQXUCY-NSHDSACASA-N. The full InChI is InChI=1S/C14H17N3O3S2/c1-11-10-16(22(19,20)14-15-6-9-21-14)7-8-17(11)12-2-4-13(18)5-3-12/h2-6,9,11,18H,7-8,10H2,1H3/t11-/m0/s1.
What are the key properties of 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol?
4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol has a molecular weight of 339.44 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenol is sourced from PubChem (CID 66586145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).