C19H18O8 — CID 66586191
6-[1-(2-methylprop-2-enoyloxy)ethyl]-2H-naphthalene-1,2,6-tricarboxylic acid (PubChem CID 66586191) has the molecular formula C19H18O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is 6-[1-(2-methylprop-2-enoyloxy)ethyl]-2H-naphthalene-1,2,6-tricarboxylic acid.
| Compound Name | 6-[1-(2-methylprop-2-enoyloxy)ethyl]-2H-naphthalene-1,2,6-tricarboxylic acid |
|---|---|
| PubChem CID | 66586191 |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 6-[1-(2-methylprop-2-enoyloxy)ethyl]-2H-naphthalene-1,2,6-tricarboxylic acid |
| SMILES | C=C(C)C(=O)OC(C)C1(C(=O)O)C=CC2=C(C(=O)O)C(C(=O)O)C=CC2=C1 |
| InChI | InChI=1S/C19H18O8/c1-9(2)17(24)27-10(3)19(18(25)26)7-6-12-11(8-19)4-5-13(15(20)21)14(12)16(22)23/h4-8,10,13H,1H2,2-3H3,(H,20,21)(H,22,23)(H,25,26) |
| InChIKey | UFJDLULAJZMLIZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|