C12H16N10O3 — CID 66586199
1-ethyl-1,3,5-triazinane-2,4,6-trione;6-(2-methyl-1H-imidazol-5-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 66586199) has the molecular formula C12H16N10O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is 1-ethyl-1,3,5-triazinane-2,4,6-trione;6-(2-methyl-1H-imidazol-5-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-ethyl-1,3,5-triazinane-2,4,6-trione;6-(2-methyl-1H-imidazol-5-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66586199 |
| Molecular Formula | C12H16N10O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-ethyl-1,3,5-triazinane-2,4,6-trione;6-(2-methyl-1H-imidazol-5-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCn1c(=O)[nH]c(=O)[nH]c1=O.Cc1ncc(-c2nc(N)nc(N)n2)[nH]1 |
| InChI | InChI=1S/C7H9N7.C5H7N3O3/c1-3-10-2-4(11-3)5-12-6(8)14-7(9)13-5;1-2-8-4(10)6-3(9)7-5(8)11/h2H,1H3,(H,10,11)(H4,8,9,12,13,14);2H2,1H3,(H2,6,7,9,10,11) |
| InChIKey | WICNDYORWZGVOC-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 207.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |