About 4-methylcyclohexa-1,5-diene-1,4-diamine
4-methylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 66586202) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 4-methylcyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 4-methylcyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 66586202 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 4-methylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | CC1(N)C=CC(N)=CC1 |
| InChI | InChI=1S/C7H12N2/c1-7(9)4-2-6(8)3-5-7/h2-4H,5,8-9H2,1H3 |
| InChIKey | OZCJSIBGTRKJGX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylcyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 4-methylcyclohexa-1,5-diene-1,4-diamine (CID 66586202) is 4-methylcyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 4-methylcyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 4-methylcyclohexa-1,5-diene-1,4-diamine is CC1(N)C=CC(N)=CC1.
What is the InChIKey of 4-methylcyclohexa-1,5-diene-1,4-diamine?
The InChIKey is OZCJSIBGTRKJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-7(9)4-2-6(8)3-5-7/h2-4H,5,8-9H2,1H3.
What are the key properties of 4-methylcyclohexa-1,5-diene-1,4-diamine?
4-methylcyclohexa-1,5-diene-1,4-diamine has a molecular weight of 124.19 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 66586202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).