About 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid
1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid (PubChem CID 66586225) has the molecular formula C7H9NO5
and a molecular weight of 187.15 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid.
Molecular Properties
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid |
| PubChem CID | 66586225 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H5NO3.C3H4O2/c6-3-1-2-4(7)5(3)8;1-2-3(4)5/h8H,1-2H2;2H,1H2,(H,4,5) |
| InChIKey | ATXASKQIXAJYLM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
The IUPAC name of 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid (CID 66586225) is 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid.
What is the SMILES notation for 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
The canonical SMILES for 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid is C=CC(=O)O.O=C1CCC(=O)N1O.
What is the InChIKey of 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
The InChIKey is ATXASKQIXAJYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.C3H4O2/c6-3-1-2-4(7)5(3)8;1-2-3(4)5/h8H,1-2H2;2H,1H2,(H,4,5).
What are the key properties of 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid has a molecular weight of 187.15 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid is sourced from PubChem (CID 66586225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).