About 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione
1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione (PubChem CID 66586311) has the molecular formula C5H8N2O4
and a molecular weight of 160.13 g/mol. Its IUPAC name is 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione |
| PubChem CID | 66586311 |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N(O)C(=O)C1O |
| InChI | InChI=1S/C5H8N2O4/c1-2-6-3(8)4(9)7(11)5(6)10/h3,8,11H,2H2,1H3 |
| InChIKey | PXPSZYNYNGZNAS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione?
The IUPAC name of 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione (CID 66586311) is 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione.
What is the SMILES notation for 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione?
The canonical SMILES for 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione is CCN1C(=O)N(O)C(=O)C1O.
What is the InChIKey of 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione?
The InChIKey is PXPSZYNYNGZNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4/c1-2-6-3(8)4(9)7(11)5(6)10/h3,8,11H,2H2,1H3.
What are the key properties of 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione?
1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione has a molecular weight of 160.13 g/mol, XLogP of -1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dihydroxyimidazolidine-2,4-dione is sourced from PubChem (CID 66586311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).