C56H52N4 — CID 66586539
2,3,5,7-tetrakis(2,4,6-trimethylphenyl)porphyrin (PubChem CID 66586539) has the molecular formula C56H52N4 and a molecular weight of 781.06 g/mol. Its IUPAC name is 2,3,5,7-tetrakis(2,4,6-trimethylphenyl)porphyrin.
| Compound Name | 2,3,5,7-tetrakis(2,4,6-trimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 66586539 |
| Molecular Formula | C56H52N4 |
| Molecular Weight | 781.06 g/mol |
| Exact Mass | 780.42 |
| IUPAC Name | 2,3,5,7-tetrakis(2,4,6-trimethylphenyl)porphyrin |
| SMILES | Cc1cc(C)c(C2=C/C3=C/C4=N/C(=C\C5=N/C(=C\C6=N/C(=C(/c7c(C)cc(C)cc7C)C2=N3)C(c2c(C)cc(C)cc2C)=C6c2c(C)cc(C)cc2C)C=C5)C=C4)c(C)c1 |
| InChI | InChI=1S/C56H52N4/c1-29-17-33(5)48(34(6)18-29)46-27-45-26-43-14-13-41(57-43)25-42-15-16-44(58-42)28-47-52(49-35(7)19-30(2)20-36(49)8)53(50-37(9)21-31(3)22-38(50)10)56(60-47)54(55(46)59-45)51-39(11)23-32(4)24-40(51)12/h13-28H,1-12H3/b41-25-,42-25-,43-26-,44-28-,45-26-,47-28-,55-54-,56-54- |
| InChIKey | YSLGVGCMKVMPBG-YHWVCWENSA-N |
| XLogP | 13.39 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.06 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|