About 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid
6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 66586665) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 66586665 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCC1(O)C=CC(O)=CC1C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-2-9(13)4-3-6(10)5-7(9)8(11)12/h3-5,7,10,13H,2H2,1H3,(H,11,12) |
| InChIKey | APOGBHMGEKFSCI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 66586665) is 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid is CCC1(O)C=CC(O)=CC1C(=O)O.
What is the InChIKey of 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is APOGBHMGEKFSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-2-9(13)4-3-6(10)5-7(9)8(11)12/h3-5,7,10,13H,2H2,1H3,(H,11,12).
What are the key properties of 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 184.19 g/mol, XLogP of 0.84, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 66586665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).