C40H56N2O6S — CID 66586702
bis(trimethyl-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium);sulfate (PubChem CID 66586702) has the molecular formula C40H56N2O6S and a molecular weight of 692.96 g/mol. Its IUPAC name is bis(trimethyl-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium);sulfate.
| Compound Name | bis(trimethyl-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium);sulfate |
|---|---|
| PubChem CID | 66586702 |
| Molecular Formula | C40H56N2O6S |
| Molecular Weight | 692.96 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | bis(trimethyl-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium);sulfate |
| SMILES | CC12CCC(C(=Cc3ccc([N+](C)(C)C)cc3)C1=O)C2(C)C.CC12CCC(C(=Cc3ccc([N+](C)(C)C)cc3)C1=O)C2(C)C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C20H28NO.H2O4S/c2*1-19(2)17-11-12-20(19,3)18(22)16(17)13-14-7-9-15(10-8-14)21(4,5)6;1-5(2,3)4/h2*7-10,13,17H,11-12H2,1-6H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | XJZYYMGDWFAFLA-UHFFFAOYSA-L |
| XLogP | 7.25 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.96 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|