C21H16ClN3O3 — CID 66587048
[3-[[6-(2-chloro-5-hydroxyphenyl)quinazolin-2-yl]amino]phenyl]methanediol (PubChem CID 66587048) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is [3-[[6-(2-chloro-5-hydroxyphenyl)quinazolin-2-yl]amino]phenyl]methanediol.
| Compound Name | [3-[[6-(2-chloro-5-hydroxyphenyl)quinazolin-2-yl]amino]phenyl]methanediol |
|---|---|
| PubChem CID | 66587048 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [3-[[6-(2-chloro-5-hydroxyphenyl)quinazolin-2-yl]amino]phenyl]methanediol |
| SMILES | Oc1ccc(Cl)c(-c2ccc3nc(Nc4cccc(C(O)O)c4)ncc3c2)c1 |
| InChI | InChI=1S/C21H16ClN3O3/c22-18-6-5-16(26)10-17(18)12-4-7-19-14(8-12)11-23-21(25-19)24-15-3-1-2-13(9-15)20(27)28/h1-11,20,26-28H,(H,23,24,25) |
| InChIKey | SKPUHGYNHQUIJJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|