C39H52N6O5Si — CID 66587112
tert-butyl 7-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 66587112) has the molecular formula C39H52N6O5Si and a molecular weight of 712.97 g/mol. Its IUPAC name is tert-butyl 7-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 7-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 66587112 |
| Molecular Formula | C39H52N6O5Si |
| Molecular Weight | 712.97 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | tert-butyl 7-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C=C(OCC)c1c(C2CC3COCC(C2)N3C(=O)OC(C)(C)C)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1NCOCC[Si](C)(C)C |
| InChI | InChI=1S/C39H52N6O5Si/c1-9-49-26(2)34-35(29-19-30-23-48-24-31(20-29)44(30)38(46)50-39(3,4)5)43-36-32(28-15-16-33(40-21-28)27-13-11-10-12-14-27)22-42-45(36)37(34)41-25-47-17-18-51(6,7)8/h10-16,21-22,29-31,41H,2,9,17-20,23-25H2,1,3-8H3 |
| InChIKey | OKCKIVIKSQOZPU-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 112.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.97 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|