C31H41FN6O4Si — CID 66587116
N-[1-[3-(6-fluoroquinolin-3-yl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]ethyl]-2,2,5-trimethyl-1,3-dioxane-5-carboxamide (PubChem CID 66587116) has the molecular formula C31H41FN6O4Si and a molecular weight of 608.79 g/mol. Its IUPAC name is N-[1-[3-(6-fluoroquinolin-3-yl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]ethyl]-2,2,5-trimethyl-1,3-dioxane-5-carboxamide.
| Compound Name | N-[1-[3-(6-fluoroquinolin-3-yl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]ethyl]-2,2,5-trimethyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 66587116 |
| Molecular Formula | C31H41FN6O4Si |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | N-[1-[3-(6-fluoroquinolin-3-yl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]ethyl]-2,2,5-trimethyl-1,3-dioxane-5-carboxamide |
| SMILES | CC(NC(=O)C1(C)COC(C)(C)OC1)c1cc(NCOCC[Si](C)(C)C)n2ncc(-c3cnc4ccc(F)cc4c3)c2n1 |
| InChI | InChI=1S/C31H41FN6O4Si/c1-20(36-29(39)31(4)17-41-30(2,3)42-18-31)26-14-27(34-19-40-10-11-43(5,6)7)38-28(37-26)24(16-35-38)22-12-21-13-23(32)8-9-25(21)33-15-22/h8-9,12-16,20,34H,10-11,17-19H2,1-7H3,(H,36,39) |
| InChIKey | CYFMIHCWDVLBCY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|