About CID 66587186
CID 66587186 (PubChem CID 66587186) has the molecular formula C13H19BFO2
and a molecular weight of 237.10 g/mol.
Molecular Properties
| Compound Name | CID 66587186 |
| PubChem CID | 66587186 |
| Molecular Formula | C13H19BFO2 |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | — |
| SMILES | Cc1cccc(F)c1[B]OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H19BFO2/c1-9-7-6-8-10(15)11(9)14-17-13(4,5)12(2,3)16/h6-8,16H,1-5H3 |
| InChIKey | AGSGAWPGWIIKHZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66587186 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66587186?
The IUPAC name of CID 66587186 (CID 66587186) is not available.
What is the SMILES notation for CID 66587186?
The canonical SMILES for CID 66587186 is Cc1cccc(F)c1[B]OC(C)(C)C(C)(C)O.
What is the InChIKey of CID 66587186?
The InChIKey is AGSGAWPGWIIKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BFO2/c1-9-7-6-8-10(15)11(9)14-17-13(4,5)12(2,3)16/h6-8,16H,1-5H3.
What are the key properties of CID 66587186?
CID 66587186 has a molecular weight of 237.10 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66587186 is sourced from PubChem (CID 66587186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).