C13H19BFO2 — CID 66587186
CID 66587186 (PubChem CID 66587186) has the molecular formula C13H19BFO2 and a molecular weight of 237.10 g/mol.
| Compound Name | CID 66587186 |
|---|---|
| PubChem CID | 66587186 |
| Molecular Formula | C13H19BFO2 |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | — |
| SMILES | Cc1cccc(F)c1[B]OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H19BFO2/c1-9-7-6-8-10(15)11(9)14-17-13(4,5)12(2,3)16/h6-8,16H,1-5H3 |
| InChIKey | AGSGAWPGWIIKHZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|