C21H27N3O2 — CID 665872
5,7-diethyl-1',5'-dimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione (PubChem CID 665872) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 5,7-diethyl-1',5'-dimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione.
| Compound Name | 5,7-diethyl-1',5'-dimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 665872 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 5,7-diethyl-1',5'-dimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione |
| SMILES | CCC12CN3CC(CC)(CN(C1)C31C(=O)N(C)c3ccc(C)cc31)C2=O |
| InChI | InChI=1S/C21H27N3O2/c1-5-19-10-23-12-20(6-2,17(19)25)13-24(11-19)21(23)15-9-14(3)7-8-16(15)22(4)18(21)26/h7-9H,5-6,10-13H2,1-4H3 |
| InChIKey | GDHKAPVLGLPBQH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |