About methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate
methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate (PubChem CID 66587522) has the molecular formula C19H20ClFN2O2
and a molecular weight of 362.83 g/mol. Its IUPAC name is methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate |
| PubChem CID | 66587522 |
| Molecular Formula | C19H20ClFN2O2 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate |
| SMILES | CCC1(C)CC(c2ccc(F)c(Cl)c2)Nc2ccc(C(=O)OC)nc21 |
| InChI | InChI=1S/C19H20ClFN2O2/c1-4-19(2)10-16(11-5-6-13(21)12(20)9-11)22-14-7-8-15(18(24)25-3)23-17(14)19/h5-9,16,22H,4,10H2,1-3H3 |
| InChIKey | RSMKJQYFRHSDHE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate?
The IUPAC name of methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate (CID 66587522) is methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate.
What is the SMILES notation for methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate?
The canonical SMILES for methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate is CCC1(C)CC(c2ccc(F)c(Cl)c2)Nc2ccc(C(=O)OC)nc21.
What is the InChIKey of methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate?
The InChIKey is RSMKJQYFRHSDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClFN2O2/c1-4-19(2)10-16(11-5-6-13(21)12(20)9-11)22-14-7-8-15(18(24)25-3)23-17(14)19/h5-9,16,22H,4,10H2,1-3H3.
What are the key properties of methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate?
methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate has a molecular weight of 362.83 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3-chloro-4-fluorophenyl)-8-ethyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate is sourced from PubChem (CID 66587522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).