C20H22N2 — CID 66587884
9-(3-phenylpropyl)-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 66587884) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 9-(3-phenylpropyl)-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-(3-phenylpropyl)-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 66587884 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 9-(3-phenylpropyl)-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | c1ccc(CCCn2c3c(c4ccccc42)CCNC3)cc1 |
| InChI | InChI=1S/C20H22N2/c1-2-7-16(8-3-1)9-6-14-22-19-11-5-4-10-17(19)18-12-13-21-15-20(18)22/h1-5,7-8,10-11,21H,6,9,12-15H2 |
| InChIKey | IZCCJTJWLMOAQA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|