C24H33N3O3 — CID 66588003
6-[8-(2-cyclohexylethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohexanoic acid (PubChem CID 66588003) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-[8-(2-cyclohexylethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohexanoic acid.
| Compound Name | 6-[8-(2-cyclohexylethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 66588003 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 6-[8-(2-cyclohexylethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)N1CCc2c(n(CCC3CCCCC3)c3ncccc23)C1 |
| InChI | InChI=1S/C24H33N3O3/c28-22(10-4-5-11-23(29)30)26-15-13-19-20-9-6-14-25-24(20)27(21(19)17-26)16-12-18-7-2-1-3-8-18/h6,9,14,18H,1-5,7-8,10-13,15-17H2,(H,29,30) |
| InChIKey | NHJRIMFHPIYRDM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|