About bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate
bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate (PubChem CID 66588426) has the molecular formula C36H42N2O6S2
and a molecular weight of 662.87 g/mol. Its IUPAC name is bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate.
Molecular Properties
| Compound Name | bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate |
| PubChem CID | 66588426 |
| Molecular Formula | C36H42N2O6S2 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC1CN(CCCOCCc2ccc3sccc3c2)C1)OC1CN(CCCOCCc2ccc3sccc3c2)C1 |
| InChI | InChI=1S/C36H42N2O6S2/c39-35(43-31-23-37(24-31)13-1-15-41-17-9-27-3-5-33-29(21-27)11-19-45-33)7-8-36(40)44-32-25-38(26-32)14-2-16-42-18-10-28-4-6-34-30(22-28)12-20-46-34/h3-8,11-12,19-22,31-32H,1-2,9-10,13-18,23-26H2/b8-7+ |
| InChIKey | UXUHPTPEZKIVRA-BQYQJAHWSA-N |
| XLogP | 5.73 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate?
The IUPAC name of bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate (CID 66588426) is bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate.
What is the SMILES notation for bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate?
The canonical SMILES for bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate is O=C(/C=C/C(=O)OC1CN(CCCOCCc2ccc3sccc3c2)C1)OC1CN(CCCOCCc2ccc3sccc3c2)C1.
What is the InChIKey of bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate?
The InChIKey is UXUHPTPEZKIVRA-BQYQJAHWSA-N. The full InChI is InChI=1S/C36H42N2O6S2/c39-35(43-31-23-37(24-31)13-1-15-41-17-9-27-3-5-33-29(21-27)11-19-45-33)7-8-36(40)44-32-25-38(26-32)14-2-16-42-18-10-28-4-6-34-30(22-28)12-20-46-34/h3-8,11-12,19-22,31-32H,1-2,9-10,13-18,23-26H2/b8-7+.
What are the key properties of bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate?
bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate has a molecular weight of 662.87 g/mol, XLogP of 5.73, 18 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] (E)-but-2-enedioate is sourced from PubChem (CID 66588426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).