About 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone
1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 66588576) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone |
| PubChem CID | 66588576 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C8H10O2/c1-7(9)8(10)5-3-2-4-6-8/h2-5,10H,6H2,1H3 |
| InChIKey | YYWLLFWGEXVUSK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone?
The IUPAC name of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone (CID 66588576) is 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone.
What is the SMILES notation for 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone?
The canonical SMILES for 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone is CC(=O)C1(O)C=CC=CC1.
What is the InChIKey of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone?
The InChIKey is YYWLLFWGEXVUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-7(9)8(10)5-3-2-4-6-8/h2-5,10H,6H2,1H3.
What are the key properties of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone?
1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone has a molecular weight of 138.17 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxycyclohexa-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 66588576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).