C26H31N5O4 — CID 66589619
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-[3-[(3,5-dimethoxyphenyl)methoxy]-1H-pyrazol-5-yl]benzamide (PubChem CID 66589619) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-[3-[(3,5-dimethoxyphenyl)methoxy]-1H-pyrazol-5-yl]benzamide.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-[3-[(3,5-dimethoxyphenyl)methoxy]-1H-pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 66589619 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-[3-[(3,5-dimethoxyphenyl)methoxy]-1H-pyrazol-5-yl]benzamide |
| SMILES | COc1cc(COc2cc(NC(=O)c3ccc(N4CCN5CCCC5C4)cc3)[nH]n2)cc(OC)c1 |
| InChI | InChI=1S/C26H31N5O4/c1-33-22-12-18(13-23(14-22)34-2)17-35-25-15-24(28-29-25)27-26(32)19-5-7-20(8-6-19)31-11-10-30-9-3-4-21(30)16-31/h5-8,12-15,21H,3-4,9-11,16-17H2,1-2H3,(H2,27,28,29,32) |
| InChIKey | AJRZAIWDKUDXTA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |