C19H28FN3O3S — CID 66590200
(2S)-2-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide (PubChem CID 66590200) has the molecular formula C19H28FN3O3S and a molecular weight of 397.52 g/mol. Its IUPAC name is (2S)-2-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide.
| Compound Name | (2S)-2-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide |
|---|---|
| PubChem CID | 66590200 |
| Molecular Formula | C19H28FN3O3S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S)-2-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide |
| SMILES | CCC[C@@H](C(N)=O)N(C)[C@@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@H]21 |
| InChI | InChI=1S/C19H28FN3O3S/c1-3-4-18(19(21)24)22(2)17-10-5-13-11-23(12-16(13)17)27(25,26)15-8-6-14(20)7-9-15/h6-9,13,16-18H,3-5,10-12H2,1-2H3,(H2,21,24)/t13-,16+,17+,18-/m0/s1 |
| InChIKey | XODSHDJJBXSIGU-LIRZEXBASA-N |
| XLogP | 1.81 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |