C24H28F3N3O3S — CID 66590207
(2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-3-phenylpropanamide (PubChem CID 66590207) has the molecular formula C24H28F3N3O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 66590207 |
| Molecular Formula | C24H28F3N3O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-3-phenylpropanamide |
| SMILES | CN([C@@H](Cc1ccccc1)C(N)=O)[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C24H28F3N3O3S/c1-29(22(23(28)31)13-16-5-3-2-4-6-16)21-12-7-17-14-30(15-20(17)21)34(32,33)19-10-8-18(9-11-19)24(25,26)27/h2-6,8-11,17,20-22H,7,12-15H2,1H3,(H2,28,31)/t17-,20+,21+,22+/m1/s1 |
| InChIKey | LMNCIFRKRQFNIF-MNAPGUCWSA-N |
| XLogP | 3.13 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |