C21H30F3N3O3S — CID 66590691
(2S)-N-[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)pentanamide (PubChem CID 66590691) has the molecular formula C21H30F3N3O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66590691 |
| Molecular Formula | C21H30F3N3O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)pentanamide |
| SMILES | CCC[C@H](NC)C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)Cc3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C21H30F3N3O3S/c1-3-4-19(25-2)20(28)26-18-10-7-15-11-27(12-17(15)18)31(29,30)13-14-5-8-16(9-6-14)21(22,23)24/h5-6,8-9,15,17-19,25H,3-4,7,10-13H2,1-2H3,(H,26,28)/t15-,17+,18+,19+/m1/s1 |
| InChIKey | JTRSAVXFEPCZRV-BVBHFADKSA-N |
| XLogP | 2.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |