About tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate
tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate (PubChem CID 66590788) has the molecular formula C13H25NO4S
and a molecular weight of 291.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate |
| PubChem CID | 66590788 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N1CCCS1(=O)=O |
| InChI | InChI=1S/C13H25NO4S/c1-10(2)9-11(12(15)18-13(3,4)5)14-7-6-8-19(14,16)17/h10-11H,6-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | NVSOKCPFBPBJJD-NSHDSACASA-N |
| XLogP | 1.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate?
The IUPAC name of tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate (CID 66590788) is tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate.
What is the SMILES notation for tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate?
The canonical SMILES for tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate is CC(C)C[C@@H](C(=O)OC(C)(C)C)N1CCCS1(=O)=O.
What is the InChIKey of tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate?
The InChIKey is NVSOKCPFBPBJJD-NSHDSACASA-N. The full InChI is InChI=1S/C13H25NO4S/c1-10(2)9-11(12(15)18-13(3,4)5)14-7-6-8-19(14,16)17/h10-11H,6-9H2,1-5H3/t11-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate?
tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate has a molecular weight of 291.41 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoate is sourced from PubChem (CID 66590788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).