C20H27BrF3N3O3S — CID 66590843
(2S)-2-[[(3aR,4S,6aS)-2-[4-bromo-3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide (PubChem CID 66590843) has the molecular formula C20H27BrF3N3O3S and a molecular weight of 526.42 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4S,6aS)-2-[4-bromo-3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide.
| Compound Name | (2S)-2-[[(3aR,4S,6aS)-2-[4-bromo-3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide |
|---|---|
| PubChem CID | 66590843 |
| Molecular Formula | C20H27BrF3N3O3S |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | (2S)-2-[[(3aR,4S,6aS)-2-[4-bromo-3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]pentanamide |
| SMILES | CCC[C@@H](C(N)=O)N(C)[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(Br)c(C(F)(F)F)c3)C[C@@H]21 |
| InChI | InChI=1S/C20H27BrF3N3O3S/c1-3-4-18(19(25)28)26(2)17-8-5-12-10-27(11-14(12)17)31(29,30)13-6-7-16(21)15(9-13)20(22,23)24/h6-7,9,12,14,17-18H,3-5,8,10-11H2,1-2H3,(H2,25,28)/t12-,14+,17+,18+/m1/s1 |
| InChIKey | UCVUNRKDHYJKLU-GLFJAGTFSA-N |
| XLogP | 3.45 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |