C12H22N2O2 — CID 66590984
[(3aS,6S,6aR)-3-tert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-6-yl]carbamic acid (PubChem CID 66590984) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is [(3aS,6S,6aR)-3-tert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-6-yl]carbamic acid.
| Compound Name | [(3aS,6S,6aR)-3-tert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-6-yl]carbamic acid |
|---|---|
| PubChem CID | 66590984 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [(3aS,6S,6aR)-3-tert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-6-yl]carbamic acid |
| SMILES | CC(C)(C)C1NC[C@@H]2[C@@H](NC(=O)O)CC[C@H]12 |
| InChI | InChI=1S/C12H22N2O2/c1-12(2,3)10-7-4-5-9(14-11(15)16)8(7)6-13-10/h7-10,13-14H,4-6H2,1-3H3,(H,15,16)/t7-,8-,9-,10?/m0/s1 |
| InChIKey | IMQGQULUYZQWCC-LUWJYHRHSA-N |
| XLogP | 1.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |