C20H29F2N3O3S — CID 66590996
(2S)-2-[[(3aS,4R,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide (PubChem CID 66590996) has the molecular formula C20H29F2N3O3S and a molecular weight of 429.53 g/mol. Its IUPAC name is (2S)-2-[[(3aS,4R,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(3aS,4R,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 66590996 |
| Molecular Formula | C20H29F2N3O3S |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2S)-2-[[(3aS,4R,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N(C)[C@@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(F)c(F)c3)C[C@H]21 |
| InChI | InChI=1S/C20H29F2N3O3S/c1-12(2)8-19(20(23)26)24(3)18-7-4-13-10-25(11-15(13)18)29(27,28)14-5-6-16(21)17(22)9-14/h5-6,9,12-13,15,18-19H,4,7-8,10-11H2,1-3H3,(H2,23,26)/t13-,15+,18+,19-/m0/s1 |
| InChIKey | DEXKFGXAXMZNIK-LZBRWLDZSA-N |
| XLogP | 2.20 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |